C35H39F3N2O5 — CID 122227086
(2S,3R,4R,5R)-N-cyclohexyl-3,4,5-tris(phenylmethoxy)-1-(2,2,2-trifluoroacetyl)piperidine-2-carboxamide (PubChem CID 122227086) has the molecular formula C35H39F3N2O5 and a molecular weight of 624.70 g/mol. Its IUPAC name is (2S,3R,4R,5R)-N-cyclohexyl-3,4,5-tris(phenylmethoxy)-1-(2,2,2-trifluoroacetyl)piperidine-2-carboxamide.
| Compound Name | (2S,3R,4R,5R)-N-cyclohexyl-3,4,5-tris(phenylmethoxy)-1-(2,2,2-trifluoroacetyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 122227086 |
| Molecular Formula | C35H39F3N2O5 |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | (2S,3R,4R,5R)-N-cyclohexyl-3,4,5-tris(phenylmethoxy)-1-(2,2,2-trifluoroacetyl)piperidine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)CN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C35H39F3N2O5/c36-35(37,38)34(42)40-21-29(43-22-25-13-5-1-6-14-25)31(44-23-26-15-7-2-8-16-26)32(45-24-27-17-9-3-10-18-27)30(40)33(41)39-28-19-11-4-12-20-28/h1-3,5-10,13-18,28-32H,4,11-12,19-24H2,(H,39,41)/t29-,30+,31-,32-/m1/s1 |
| InChIKey | BAITWJZXBZILSF-VWPRMMSESA-N |
| XLogP | 5.96 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |