C15H16N2O4 — CID 122227150
(3R,7aS)-N-methoxy-N-methyl-5-oxo-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide (PubChem CID 122227150) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is (3R,7aS)-N-methoxy-N-methyl-5-oxo-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide.
| Compound Name | (3R,7aS)-N-methoxy-N-methyl-5-oxo-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide |
|---|---|
| PubChem CID | 122227150 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (3R,7aS)-N-methoxy-N-methyl-5-oxo-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide |
| SMILES | CON(C)C(=O)C1=C[C@H]2CO[C@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C15H16N2O4/c1-16(20-2)13(18)12-8-11-9-21-15(17(11)14(12)19)10-6-4-3-5-7-10/h3-8,11,15H,9H2,1-2H3/t11-,15+/m0/s1 |
| InChIKey | VPAFPPYIYWRGDQ-XHDPSFHLSA-N |
| XLogP | 0.87 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|