C18H26O4 — CID 122228613
(6-oxo-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl) 4,7,7-trimethyl-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 122228613) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (6-oxo-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl) 4,7,7-trimethyl-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | (6-oxo-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl) 4,7,7-trimethyl-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 122228613 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (6-oxo-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl) 4,7,7-trimethyl-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC12CCC(C(=O)OC3CCC4CCC(=O)C43)(OC1)C2(C)C |
| InChI | InChI=1S/C18H26O4/c1-16(2)17(3)8-9-18(16,21-10-17)15(20)22-13-7-5-11-4-6-12(19)14(11)13/h11,13-14H,4-10H2,1-3H3 |
| InChIKey | NLNVRVXIQPQHPZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |