C27H27N7 — CID 122230590
2,4-di(piperazin-1-yl)-6-pyren-1-yl-1,3,5-triazine (PubChem CID 122230590) has the molecular formula C27H27N7 and a molecular weight of 449.56 g/mol. Its IUPAC name is 2,4-di(piperazin-1-yl)-6-pyren-1-yl-1,3,5-triazine.
| Compound Name | 2,4-di(piperazin-1-yl)-6-pyren-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 122230590 |
| Molecular Formula | C27H27N7 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 2,4-di(piperazin-1-yl)-6-pyren-1-yl-1,3,5-triazine |
| SMILES | c1cc2ccc3ccc(-c4nc(N5CCNCC5)nc(N5CCNCC5)n4)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C27H27N7/c1-2-18-4-5-20-7-9-22(21-8-6-19(3-1)23(18)24(20)21)25-30-26(33-14-10-28-11-15-33)32-27(31-25)34-16-12-29-13-17-34/h1-9,28-29H,10-17H2 |
| InChIKey | YRMQVOUHMSOXAO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|