C11H16O3 — CID 122231149
(1R,3S,5S,7S)-9,9-dimethyl-6-methylidene-2,8,10-trioxatricyclo[5.4.0.03,5]undecane (PubChem CID 122231149) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1R,3S,5S,7S)-9,9-dimethyl-6-methylidene-2,8,10-trioxatricyclo[5.4.0.03,5]undecane.
| Compound Name | (1R,3S,5S,7S)-9,9-dimethyl-6-methylidene-2,8,10-trioxatricyclo[5.4.0.03,5]undecane |
|---|---|
| PubChem CID | 122231149 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1R,3S,5S,7S)-9,9-dimethyl-6-methylidene-2,8,10-trioxatricyclo[5.4.0.03,5]undecane |
| SMILES | C=C1[C@@H]2C[C@@H]2O[C@@H]2COC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C11H16O3/c1-6-7-4-8(7)13-9-5-12-11(2,3)14-10(6)9/h7-10H,1,4-5H2,2-3H3/t7-,8-,9+,10-/m0/s1 |
| InChIKey | VJTBARYEFPBKTP-QEYWKRMJSA-N |
| XLogP | 1.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|