C12H20O3 — CID 145030205
7-methoxy-2,2-dimethyl-5-methylidene-4,4a,6,7,8,8a-hexahydrobenzo[d][1,3]dioxine (PubChem CID 145030205) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethyl-5-methylidene-4,4a,6,7,8,8a-hexahydrobenzo[d][1,3]dioxine.
| Compound Name | 7-methoxy-2,2-dimethyl-5-methylidene-4,4a,6,7,8,8a-hexahydrobenzo[d][1,3]dioxine |
|---|---|
| PubChem CID | 145030205 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 7-methoxy-2,2-dimethyl-5-methylidene-4,4a,6,7,8,8a-hexahydrobenzo[d][1,3]dioxine |
| SMILES | C=C1CC(OC)CC2OC(C)(C)OCC12 |
| InChI | InChI=1S/C12H20O3/c1-8-5-9(13-4)6-11-10(8)7-14-12(2,3)15-11/h9-11H,1,5-7H2,2-4H3 |
| InChIKey | AHUOCQBMBQSIMP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|