C32H16F12 — CID 122231455
(1E)-5-(trifluoromethyl)-2,3-bis[4-(trifluoromethyl)phenyl]-1-[[4-(trifluoromethyl)phenyl]methylidene]indene (PubChem CID 122231455) has the molecular formula C32H16F12 and a molecular weight of 628.46 g/mol. Its IUPAC name is (1E)-5-(trifluoromethyl)-2,3-bis[4-(trifluoromethyl)phenyl]-1-[[4-(trifluoromethyl)phenyl]methylidene]indene.
| Compound Name | (1E)-5-(trifluoromethyl)-2,3-bis[4-(trifluoromethyl)phenyl]-1-[[4-(trifluoromethyl)phenyl]methylidene]indene |
|---|---|
| PubChem CID | 122231455 |
| Molecular Formula | C32H16F12 |
| Molecular Weight | 628.46 g/mol |
| Exact Mass | 628.11 |
| IUPAC Name | (1E)-5-(trifluoromethyl)-2,3-bis[4-(trifluoromethyl)phenyl]-1-[[4-(trifluoromethyl)phenyl]methylidene]indene |
| SMILES | FC(F)(F)c1ccc(/C=C2/C(c3ccc(C(F)(F)F)cc3)=C(c3ccc(C(F)(F)F)cc3)c3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C32H16F12/c33-29(34,35)20-7-1-17(2-8-20)15-25-24-14-13-23(32(42,43)44)16-26(24)28(19-5-11-22(12-6-19)31(39,40)41)27(25)18-3-9-21(10-4-18)30(36,37)38/h1-16H/b25-15+ |
| InChIKey | YQTCBSQBOGWVFA-MFKUBSTISA-N |
| XLogP | 11.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.46 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|