C62H72O4S4 — CID 122232349
bis[3,5-bis(phenylsulfanylmethyl)phenyl] (E)-docos-11-enedioate (PubChem CID 122232349) has the molecular formula C62H72O4S4 and a molecular weight of 1009.52 g/mol. Its IUPAC name is bis[3,5-bis(phenylsulfanylmethyl)phenyl] (E)-docos-11-enedioate.
| Compound Name | bis[3,5-bis(phenylsulfanylmethyl)phenyl] (E)-docos-11-enedioate |
|---|---|
| PubChem CID | 122232349 |
| Molecular Formula | C62H72O4S4 |
| Molecular Weight | 1009.52 g/mol |
| Exact Mass | 1008.43 |
| IUPAC Name | bis[3,5-bis(phenylsulfanylmethyl)phenyl] (E)-docos-11-enedioate |
| SMILES | O=C(CCCCCCCCC/C=C/CCCCCCCCCC(=O)Oc1cc(CSc2ccccc2)cc(CSc2ccccc2)c1)Oc1cc(CSc2ccccc2)cc(CSc2ccccc2)c1 |
| InChI | InChI=1S/C62H72O4S4/c63-61(65-55-43-51(47-67-57-31-21-17-22-32-57)41-52(44-55)48-68-58-33-23-18-24-34-58)39-29-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-30-40-62(64)66-56-45-53(49-69-59-35-25-19-26-36-59)42-54(46-56)50-70-60-37-27-20-28-38-60/h1-2,17-28,31-38,41-46H,3-16,29-30,39-40,47-50H2/b2-1+ |
| InChIKey | SRDWBVBFAPKAAH-OWOJBTEDSA-N |
| XLogP | 18.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.52 |
| LogP ≤ 5 | 18.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|