C22H17F2NO — CID 122232912
(3S,4R)-1-benzyl-3-fluoro-3-(3-fluorophenyl)-4-phenylazetidin-2-one (PubChem CID 122232912) has the molecular formula C22H17F2NO and a molecular weight of 349.38 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3-fluoro-3-(3-fluorophenyl)-4-phenylazetidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-3-fluoro-3-(3-fluorophenyl)-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 122232912 |
| Molecular Formula | C22H17F2NO |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (3S,4R)-1-benzyl-3-fluoro-3-(3-fluorophenyl)-4-phenylazetidin-2-one |
| SMILES | O=C1N(Cc2ccccc2)[C@H](c2ccccc2)[C@@]1(F)c1cccc(F)c1 |
| InChI | InChI=1S/C22H17F2NO/c23-19-13-7-12-18(14-19)22(24)20(17-10-5-2-6-11-17)25(21(22)26)15-16-8-3-1-4-9-16/h1-14,20H,15H2/t20-,22+/m1/s1 |
| InChIKey | MIVYNUCCLGVFCR-IRLDBZIGSA-N |
| XLogP | 4.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |