C15H18O4 — CID 122233729
(6R,8R,8aR)-6,8-dihydroxy-3,5,8a-trimethyl-6,7,8,9-tetrahydrobenzo[f][1]benzofuran-4-one (PubChem CID 122233729) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (6R,8R,8aR)-6,8-dihydroxy-3,5,8a-trimethyl-6,7,8,9-tetrahydrobenzo[f][1]benzofuran-4-one.
| Compound Name | (6R,8R,8aR)-6,8-dihydroxy-3,5,8a-trimethyl-6,7,8,9-tetrahydrobenzo[f][1]benzofuran-4-one |
|---|---|
| PubChem CID | 122233729 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (6R,8R,8aR)-6,8-dihydroxy-3,5,8a-trimethyl-6,7,8,9-tetrahydrobenzo[f][1]benzofuran-4-one |
| SMILES | CC1=C2C(=O)c3c(C)coc3C[C@@]2(C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H18O4/c1-7-6-19-10-5-15(3)11(17)4-9(16)8(2)13(15)14(18)12(7)10/h6,9,11,16-17H,4-5H2,1-3H3/t9-,11-,15+/m1/s1 |
| InChIKey | OWTHATSJKADCEB-OSQNNJELSA-N |
| XLogP | 1.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |