C6H6N2OS — CID 122241789
3-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-yn-1-ol (PubChem CID 122241789) has the molecular formula C6H6N2OS and a molecular weight of 154.19 g/mol. Its IUPAC name is 3-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-yn-1-ol.
| Compound Name | 3-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 122241789 |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 3-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-yn-1-ol |
| SMILES | Cc1nsc(C#CCO)n1 |
| InChI | InChI=1S/C6H6N2OS/c1-5-7-6(10-8-5)3-2-4-9/h9H,4H2,1H3 |
| InChIKey | CDBSIGQYBUYRET-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|