C5H4N2S — CID 118466089
5-ethynyl-3-methyl-1,2,4-thiadiazole (PubChem CID 118466089) has the molecular formula C5H4N2S and a molecular weight of 124.17 g/mol. Its IUPAC name is 5-ethynyl-3-methyl-1,2,4-thiadiazole.
| Compound Name | 5-ethynyl-3-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 118466089 |
| Molecular Formula | C5H4N2S |
| Molecular Weight | 124.17 g/mol |
| Exact Mass | 124.01 |
| IUPAC Name | 5-ethynyl-3-methyl-1,2,4-thiadiazole |
| SMILES | C#Cc1nc(C)ns1 |
| InChI | InChI=1S/C5H4N2S/c1-3-5-6-4(2)7-8-5/h1H,2H3 |
| InChIKey | XTVZKBNBPGMKLQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|