C18H13NO4 — CID 122244115
N-[[5-(furan-3-yl)furan-2-yl]methyl]-1-benzofuran-2-carboxamide (PubChem CID 122244115) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-[[5-(furan-3-yl)furan-2-yl]methyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[5-(furan-3-yl)furan-2-yl]methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 122244115 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-[[5-(furan-3-yl)furan-2-yl]methyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCc1ccc(-c2ccoc2)o1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H13NO4/c20-18(17-9-12-3-1-2-4-15(12)23-17)19-10-14-5-6-16(22-14)13-7-8-21-11-13/h1-9,11H,10H2,(H,19,20) |
| InChIKey | WVRBBKKBBMXLQY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |