C16H15F2NO2S — CID 122246206
(3,4-difluorophenyl)-(4-thiophen-3-yloxypiperidin-1-yl)methanone (PubChem CID 122246206) has the molecular formula C16H15F2NO2S and a molecular weight of 323.36 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(4-thiophen-3-yloxypiperidin-1-yl)methanone.
| Compound Name | (3,4-difluorophenyl)-(4-thiophen-3-yloxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 122246206 |
| Molecular Formula | C16H15F2NO2S |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (3,4-difluorophenyl)-(4-thiophen-3-yloxypiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)N1CCC(Oc2ccsc2)CC1 |
| InChI | InChI=1S/C16H15F2NO2S/c17-14-2-1-11(9-15(14)18)16(20)19-6-3-12(4-7-19)21-13-5-8-22-10-13/h1-2,5,8-10,12H,3-4,6-7H2 |
| InChIKey | RHFLYXXNWJAMFU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |