C18H14F6N2O — CID 122246902
N-[(5-cyclopropyl-3-pyridinyl)methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 122246902) has the molecular formula C18H14F6N2O and a molecular weight of 388.31 g/mol. Its IUPAC name is N-[(5-cyclopropyl-3-pyridinyl)methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(5-cyclopropyl-3-pyridinyl)methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 122246902 |
| Molecular Formula | C18H14F6N2O |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[(5-cyclopropyl-3-pyridinyl)methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCc1cncc(C2CC2)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F6N2O/c19-17(20,21)14-4-12(5-15(6-14)18(22,23)24)16(27)26-8-10-3-13(9-25-7-10)11-1-2-11/h3-7,9,11H,1-2,8H2,(H,26,27) |
| InChIKey | OMFFSNZDGORTDQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |