C16H15F6N5O — CID 30295463
N-[(1-cyclopentyltetrazol-5-yl)methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 30295463) has the molecular formula C16H15F6N5O and a molecular weight of 407.32 g/mol. Its IUPAC name is N-[(1-cyclopentyltetrazol-5-yl)methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(1-cyclopentyltetrazol-5-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 30295463 |
| Molecular Formula | C16H15F6N5O |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[(1-cyclopentyltetrazol-5-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCc1nnnn1C1CCCC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F6N5O/c17-15(18,19)10-5-9(6-11(7-10)16(20,21)22)14(28)23-8-13-24-25-26-27(13)12-3-1-2-4-12/h5-7,12H,1-4,8H2,(H,23,28) |
| InChIKey | FFNKUOGVEOKSQN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |