C16H22N2O2 — CID 122247079
3-cyclopentyl-1-(3-pyridin-2-yloxyazetidin-1-yl)propan-1-one (PubChem CID 122247079) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-cyclopentyl-1-(3-pyridin-2-yloxyazetidin-1-yl)propan-1-one.
| Compound Name | 3-cyclopentyl-1-(3-pyridin-2-yloxyazetidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 122247079 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-cyclopentyl-1-(3-pyridin-2-yloxyazetidin-1-yl)propan-1-one |
| SMILES | O=C(CCC1CCCC1)N1CC(Oc2ccccn2)C1 |
| InChI | InChI=1S/C16H22N2O2/c19-16(9-8-13-5-1-2-6-13)18-11-14(12-18)20-15-7-3-4-10-17-15/h3-4,7,10,13-14H,1-2,5-6,8-9,11-12H2 |
| InChIKey | RYQIOWMNGZRFHX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |