About 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one
3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one (PubChem CID 90627445) has the molecular formula C15H22N2O2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one |
| PubChem CID | 90627445 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one |
| SMILES | O=C(CCC1CCCCC1)N1CC(Oc2nccs2)C1 |
| InChI | InChI=1S/C15H22N2O2S/c18-14(7-6-12-4-2-1-3-5-12)17-10-13(11-17)19-15-16-8-9-20-15/h8-9,12-13H,1-7,10-11H2 |
| InChIKey | ZXBSJDTYLNXLHS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one?
The IUPAC name of 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one (CID 90627445) is 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one.
What is the SMILES notation for 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one?
The canonical SMILES for 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one is O=C(CCC1CCCCC1)N1CC(Oc2nccs2)C1.
What is the InChIKey of 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one?
The InChIKey is ZXBSJDTYLNXLHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2S/c18-14(7-6-12-4-2-1-3-5-12)17-10-13(11-17)19-15-16-8-9-20-15/h8-9,12-13H,1-7,10-11H2.
What are the key properties of 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one?
3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one has a molecular weight of 294.42 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1-[3-(1,3-thiazol-2-yloxy)azetidin-1-yl]propan-1-one is sourced from PubChem (CID 90627445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).