C15H12N4O5S — CID 122248957
6-[1-(3-nitrophenyl)sulfonylazetidin-3-yl]oxypyridine-3-carbonitrile (PubChem CID 122248957) has the molecular formula C15H12N4O5S and a molecular weight of 360.35 g/mol. Its IUPAC name is 6-[1-(3-nitrophenyl)sulfonylazetidin-3-yl]oxypyridine-3-carbonitrile.
| Compound Name | 6-[1-(3-nitrophenyl)sulfonylazetidin-3-yl]oxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 122248957 |
| Molecular Formula | C15H12N4O5S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 6-[1-(3-nitrophenyl)sulfonylazetidin-3-yl]oxypyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(OC2CN(S(=O)(=O)c3cccc([N+](=O)[O-])c3)C2)nc1 |
| InChI | InChI=1S/C15H12N4O5S/c16-7-11-4-5-15(17-8-11)24-13-9-18(10-13)25(22,23)14-3-1-2-12(6-14)19(20)21/h1-6,8,13H,9-10H2 |
| InChIKey | YQIMZOOSHQXVSP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 126.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|