C14H13N3O3S2 — CID 122248959
6-[1-(5-methylthiophen-2-yl)sulfonylazetidin-3-yl]oxypyridine-3-carbonitrile (PubChem CID 122248959) has the molecular formula C14H13N3O3S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 6-[1-(5-methylthiophen-2-yl)sulfonylazetidin-3-yl]oxypyridine-3-carbonitrile.
| Compound Name | 6-[1-(5-methylthiophen-2-yl)sulfonylazetidin-3-yl]oxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 122248959 |
| Molecular Formula | C14H13N3O3S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 6-[1-(5-methylthiophen-2-yl)sulfonylazetidin-3-yl]oxypyridine-3-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(Oc3ccc(C#N)cn3)C2)s1 |
| InChI | InChI=1S/C14H13N3O3S2/c1-10-2-5-14(21-10)22(18,19)17-8-12(9-17)20-13-4-3-11(6-15)7-16-13/h2-5,7,12H,8-9H2,1H3 |
| InChIKey | QZIXMUJBATWFNU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |