C20H21Cl2NO3S — CID 122255625
8-[4-(3,4-dichlorophenyl)phenyl]sulfonyl-3-methoxy-8-azabicyclo[3.2.1]octane (PubChem CID 122255625) has the molecular formula C20H21Cl2NO3S and a molecular weight of 426.37 g/mol. Its IUPAC name is 8-[4-(3,4-dichlorophenyl)phenyl]sulfonyl-3-methoxy-8-azabicyclo[3.2.1]octane.
| Compound Name | 8-[4-(3,4-dichlorophenyl)phenyl]sulfonyl-3-methoxy-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 122255625 |
| Molecular Formula | C20H21Cl2NO3S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 8-[4-(3,4-dichlorophenyl)phenyl]sulfonyl-3-methoxy-8-azabicyclo[3.2.1]octane |
| SMILES | COC1CC2CCC(C1)N2S(=O)(=O)c1ccc(-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H21Cl2NO3S/c1-26-17-11-15-5-6-16(12-17)23(15)27(24,25)18-7-2-13(3-8-18)14-4-9-19(21)20(22)10-14/h2-4,7-10,15-17H,5-6,11-12H2,1H3 |
| InChIKey | SLDKWSORPITTSG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |