C18H19F3N4O3 — CID 122267643
(6-ethoxy-3-pyridinyl)-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone (PubChem CID 122267643) has the molecular formula C18H19F3N4O3 and a molecular weight of 396.37 g/mol. Its IUPAC name is (6-ethoxy-3-pyridinyl)-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone.
| Compound Name | (6-ethoxy-3-pyridinyl)-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 122267643 |
| Molecular Formula | C18H19F3N4O3 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (6-ethoxy-3-pyridinyl)-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone |
| SMILES | CCOc1ccc(C(=O)N2CCCC(Oc3nccc(C(F)(F)F)n3)C2)cn1 |
| InChI | InChI=1S/C18H19F3N4O3/c1-2-27-15-6-5-12(10-23-15)16(26)25-9-3-4-13(11-25)28-17-22-8-7-14(24-17)18(19,20)21/h5-8,10,13H,2-4,9,11H2,1H3 |
| InChIKey | HQQRDJIZKWZRAS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |