C22H26F3N3O3 — CID 122267669
(4-pentoxyphenyl)-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone (PubChem CID 122267669) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is (4-pentoxyphenyl)-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone.
| Compound Name | (4-pentoxyphenyl)-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 122267669 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | (4-pentoxyphenyl)-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone |
| SMILES | CCCCCOc1ccc(C(=O)N2CCCC(Oc3nccc(C(F)(F)F)n3)C2)cc1 |
| InChI | InChI=1S/C22H26F3N3O3/c1-2-3-4-14-30-17-9-7-16(8-10-17)20(29)28-13-5-6-18(15-28)31-21-26-12-11-19(27-21)22(23,24)25/h7-12,18H,2-6,13-15H2,1H3 |
| InChIKey | PUMXBUVBCGJVKF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|