C21H25N5O2 — CID 122275516
1-(4-butoxyphenyl)-3-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]urea (PubChem CID 122275516) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]urea.
| Compound Name | 1-(4-butoxyphenyl)-3-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 122275516 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-[[2-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]urea |
| SMILES | CCCCOc1ccc(NC(=O)NCc2cccnc2-c2cnn(C)c2)cc1 |
| InChI | InChI=1S/C21H25N5O2/c1-3-4-12-28-19-9-7-18(8-10-19)25-21(27)23-13-16-6-5-11-22-20(16)17-14-24-26(2)15-17/h5-11,14-15H,3-4,12-13H2,1-2H3,(H2,23,25,27) |
| InChIKey | IKOVTTGWUJTSCJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|