C21H25N3O5 — CID 122280480
(E)-N-[2-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 122280480) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is (E)-N-[2-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 122280480 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (E)-N-[2-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCn2nc3c(cc2=O)CCC3)cc(OC)c1OC |
| InChI | InChI=1S/C21H25N3O5/c1-27-17-11-14(12-18(28-2)21(17)29-3)7-8-19(25)22-9-10-24-20(26)13-15-5-4-6-16(15)23-24/h7-8,11-13H,4-6,9-10H2,1-3H3,(H,22,25)/b8-7+ |
| InChIKey | CKLJPUQBQYSZKH-BQYQJAHWSA-N |
| XLogP | 1.59 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|