C11H15N5O2 — CID 122282464
4-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]-1,2-oxazolidin-3-one (PubChem CID 122282464) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]-1,2-oxazolidin-3-one.
| Compound Name | 4-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]-1,2-oxazolidin-3-one |
|---|---|
| PubChem CID | 122282464 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 4-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]-1,2-oxazolidin-3-one |
| SMILES | O=C1NOCC1Nc1cc(N2CCCC2)ncn1 |
| InChI | InChI=1S/C11H15N5O2/c17-11-8(6-18-15-11)14-9-5-10(13-7-12-9)16-3-1-2-4-16/h5,7-8H,1-4,6H2,(H,15,17)(H,12,13,14) |
| InChIKey | NZYWQICPMKJENN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |