C23H18N2O2S2 — CID 122286209
(E)-2-phenyl-N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]ethenesulfonamide (PubChem CID 122286209) has the molecular formula C23H18N2O2S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (E)-2-phenyl-N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]ethenesulfonamide.
| Compound Name | (E)-2-phenyl-N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]ethenesulfonamide |
|---|---|
| PubChem CID | 122286209 |
| Molecular Formula | C23H18N2O2S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (E)-2-phenyl-N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]ethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccccc1)Nc1cccc(-c2csc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H18N2O2S2/c26-29(27,15-14-18-8-3-1-4-9-18)25-21-13-7-12-20(16-21)22-17-28-23(24-22)19-10-5-2-6-11-19/h1-17,25H/b15-14+ |
| InChIKey | FKNLCQFBNRBTDT-CCEZHUSRSA-N |
| XLogP | 5.89 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |