C23H20N2O2S — CID 22640485
(E)-N-[3-(3,4-dihydroisoquinolin-1-yl)phenyl]-2-phenylethenesulfonamide (PubChem CID 22640485) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is (E)-N-[3-(3,4-dihydroisoquinolin-1-yl)phenyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[3-(3,4-dihydroisoquinolin-1-yl)phenyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 22640485 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (E)-N-[3-(3,4-dihydroisoquinolin-1-yl)phenyl]-2-phenylethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccccc1)Nc1cccc(C2=NCCc3ccccc32)c1 |
| InChI | InChI=1S/C23H20N2O2S/c26-28(27,16-14-18-7-2-1-3-8-18)25-21-11-6-10-20(17-21)23-22-12-5-4-9-19(22)13-15-24-23/h1-12,14,16-17,25H,13,15H2/b16-14+ |
| InChIKey | UDLJKIFKMZACRR-JQIJEIRASA-N |
| XLogP | 4.49 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |