C21H16F2N2O2S — CID 22640501
N-[4-(3,4-dihydroisoquinolin-1-yl)phenyl]-2,6-difluorobenzenesulfonamide (PubChem CID 22640501) has the molecular formula C21H16F2N2O2S and a molecular weight of 398.43 g/mol. Its IUPAC name is N-[4-(3,4-dihydroisoquinolin-1-yl)phenyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[4-(3,4-dihydroisoquinolin-1-yl)phenyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22640501 |
| Molecular Formula | C21H16F2N2O2S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[4-(3,4-dihydroisoquinolin-1-yl)phenyl]-2,6-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(C2=NCCc3ccccc32)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C21H16F2N2O2S/c22-18-6-3-7-19(23)21(18)28(26,27)25-16-10-8-15(9-11-16)20-17-5-2-1-4-14(17)12-13-24-20/h1-11,25H,12-13H2 |
| InChIKey | FGFZSWGRFLPYEY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |