C31H24N2O3S — CID 22640511
N-[4-(7-phenoxy-3,4-dihydroisoquinolin-1-yl)phenyl]naphthalene-2-sulfonamide (PubChem CID 22640511) has the molecular formula C31H24N2O3S and a molecular weight of 504.61 g/mol. Its IUPAC name is N-[4-(7-phenoxy-3,4-dihydroisoquinolin-1-yl)phenyl]naphthalene-2-sulfonamide.
| Compound Name | N-[4-(7-phenoxy-3,4-dihydroisoquinolin-1-yl)phenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 22640511 |
| Molecular Formula | C31H24N2O3S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | N-[4-(7-phenoxy-3,4-dihydroisoquinolin-1-yl)phenyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(C2=NCCc3ccc(Oc4ccccc4)cc32)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H24N2O3S/c34-37(35,29-17-13-22-6-4-5-7-25(22)20-29)33-26-14-10-24(11-15-26)31-30-21-28(16-12-23(30)18-19-32-31)36-27-8-2-1-3-9-27/h1-17,20-21,33H,18-19H2 |
| InChIKey | MMLQMRBFVRBOGV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |