C14H15FN4O2 — CID 122302636
1-(3-fluorophenyl)-3-(2-methoxy-4,6-dimethylpyrimidin-5-yl)urea (PubChem CID 122302636) has the molecular formula C14H15FN4O2 and a molecular weight of 290.30 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-(2-methoxy-4,6-dimethylpyrimidin-5-yl)urea.
| Compound Name | 1-(3-fluorophenyl)-3-(2-methoxy-4,6-dimethylpyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 122302636 |
| Molecular Formula | C14H15FN4O2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-(3-fluorophenyl)-3-(2-methoxy-4,6-dimethylpyrimidin-5-yl)urea |
| SMILES | COc1nc(C)c(NC(=O)Nc2cccc(F)c2)c(C)n1 |
| InChI | InChI=1S/C14H15FN4O2/c1-8-12(9(2)17-14(16-8)21-3)19-13(20)18-11-6-4-5-10(15)7-11/h4-7H,1-3H3,(H2,18,19,20) |
| InChIKey | UJHILOBEMUHKPV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |