C19H23BFN3O4 — CID 167531042
1-(3-fluorophenyl)-3-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]urea (PubChem CID 167531042) has the molecular formula C19H23BFN3O4 and a molecular weight of 387.22 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 167531042 |
| Molecular Formula | C19H23BFN3O4 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]urea |
| SMILES | COc1ncc(B2OC(C)(C)C(C)(C)O2)cc1NC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H23BFN3O4/c1-18(2)19(3,4)28-20(27-18)12-9-15(16(26-5)22-11-12)24-17(25)23-14-8-6-7-13(21)10-14/h6-11H,1-5H3,(H2,23,24,25) |
| InChIKey | KYQXYJOHKIUJNM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|