C20H24BFN2O4 — CID 171392953
1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-methoxyphenyl)urea (PubChem CID 171392953) has the molecular formula C20H24BFN2O4 and a molecular weight of 386.23 g/mol. Its IUPAC name is 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 171392953 |
| Molecular Formula | C20H24BFN2O4 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1 |
| InChI | InChI=1S/C20H24BFN2O4/c1-19(2)20(3,4)28-21(27-19)14-11-10-13(12-15(14)22)23-18(25)24-16-8-6-7-9-17(16)26-5/h6-12H,1-5H3,(H2,23,24,25) |
| InChIKey | BEOMSQWGNMKUKX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|