C24H24BFN2O4 — CID 140810623
N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxo-1-phenylpyridine-3-carboxamide (PubChem CID 140810623) has the molecular formula C24H24BFN2O4 and a molecular weight of 434.28 g/mol. Its IUPAC name is N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxo-1-phenylpyridine-3-carboxamide.
| Compound Name | N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxo-1-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 140810623 |
| Molecular Formula | C24H24BFN2O4 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxo-1-phenylpyridine-3-carboxamide |
| SMILES | CC1(C)OB(c2ccc(NC(=O)c3cccn(-c4ccccc4)c3=O)cc2F)OC1(C)C |
| InChI | InChI=1S/C24H24BFN2O4/c1-23(2)24(3,4)32-25(31-23)19-13-12-16(15-20(19)26)27-21(29)18-11-8-14-28(22(18)30)17-9-6-5-7-10-17/h5-15H,1-4H3,(H,27,29) |
| InChIKey | BHIAHWRMLPHEEN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|