About N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide
N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide (PubChem CID 122303452) has the molecular formula C18H19FN4O3
and a molecular weight of 358.37 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide |
| PubChem CID | 122303452 |
| Molecular Formula | C18H19FN4O3 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1nc(Oc2ccccc2F)nc(C)c1NC(=O)C1CCC(=O)NC1 |
| InChI | InChI=1S/C18H19FN4O3/c1-10-16(23-17(25)12-7-8-15(24)20-9-12)11(2)22-18(21-10)26-14-6-4-3-5-13(14)19/h3-6,12H,7-9H2,1-2H3,(H,20,24)(H,23,25) |
| InChIKey | NKCHRXFUXVTRNH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide?
The IUPAC name of N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide (CID 122303452) is N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide.
What is the SMILES notation for N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide?
The canonical SMILES for N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide is Cc1nc(Oc2ccccc2F)nc(C)c1NC(=O)C1CCC(=O)NC1.
What is the InChIKey of N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide?
The InChIKey is NKCHRXFUXVTRNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN4O3/c1-10-16(23-17(25)12-7-8-15(24)20-9-12)11(2)22-18(21-10)26-14-6-4-3-5-13(14)19/h3-6,12H,7-9H2,1-2H3,(H,20,24)(H,23,25).
What are the key properties of N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide?
N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide has a molecular weight of 358.37 g/mol, XLogP of 2.49, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-6-oxopiperidine-3-carboxamide is sourced from PubChem (CID 122303452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).