C16H19ClN4O3 — CID 122304312
1-(3-chloro-4-methylphenyl)-3-(2,4-diethoxypyrimidin-5-yl)urea (PubChem CID 122304312) has the molecular formula C16H19ClN4O3 and a molecular weight of 350.81 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-(2,4-diethoxypyrimidin-5-yl)urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-(2,4-diethoxypyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 122304312 |
| Molecular Formula | C16H19ClN4O3 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-(2,4-diethoxypyrimidin-5-yl)urea |
| SMILES | CCOc1ncc(NC(=O)Nc2ccc(C)c(Cl)c2)c(OCC)n1 |
| InChI | InChI=1S/C16H19ClN4O3/c1-4-23-14-13(9-18-16(21-14)24-5-2)20-15(22)19-11-7-6-10(3)12(17)8-11/h6-9H,4-5H2,1-3H3,(H2,19,20,22) |
| InChIKey | XRBVZJFHYKJCRN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |