C21H17ClN6O3 — CID 122304687
1-(5-chloro-2-methoxyphenyl)-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea (PubChem CID 122304687) has the molecular formula C21H17ClN6O3 and a molecular weight of 436.86 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 122304687 |
| Molecular Formula | C21H17ClN6O3 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)Nc1ccc(Oc2ccc(-n3cccn3)nn2)cc1 |
| InChI | InChI=1S/C21H17ClN6O3/c1-30-18-8-3-14(22)13-17(18)25-21(29)24-15-4-6-16(7-5-15)31-20-10-9-19(26-27-20)28-12-2-11-23-28/h2-13H,1H3,(H2,24,25,29) |
| InChIKey | GCYQUWXLSWFDFA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |