C19H23F3N6O2 — CID 122320139
1-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 122320139) has the molecular formula C19H23F3N6O2 and a molecular weight of 424.43 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 122320139 |
| Molecular Formula | C19H23F3N6O2 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | CN(C)c1nc(N2CCCCC2)ncc1NC(=O)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C19H23F3N6O2/c1-27(2)16-14(12-23-17(26-16)28-10-6-3-7-11-28)25-18(29)24-13-8-4-5-9-15(13)30-19(20,21)22/h4-5,8-9,12H,3,6-7,10-11H2,1-2H3,(H2,24,25,29) |
| InChIKey | IHLWWSRXLPCJSW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |