C18H18BrN5O2S — CID 122322139
2-bromo-N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]benzenesulfonamide (PubChem CID 122322139) has the molecular formula C18H18BrN5O2S and a molecular weight of 448.35 g/mol. Its IUPAC name is 2-bromo-N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122322139 |
| Molecular Formula | C18H18BrN5O2S |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 2-bromo-N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]benzenesulfonamide |
| SMILES | CN(C)c1cnnc(Nc2ccc(NS(=O)(=O)c3ccccc3Br)cc2)c1 |
| InChI | InChI=1S/C18H18BrN5O2S/c1-24(2)15-11-18(22-20-12-15)21-13-7-9-14(10-8-13)23-27(25,26)17-6-4-3-5-16(17)19/h3-12,23H,1-2H3,(H,21,22) |
| InChIKey | JJZLNRQFEHTIDC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |