C18H18N6O4S — CID 122322166
N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-4-nitrobenzenesulfonamide (PubChem CID 122322166) has the molecular formula C18H18N6O4S and a molecular weight of 414.45 g/mol. Its IUPAC name is N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122322166 |
| Molecular Formula | C18H18N6O4S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-4-nitrobenzenesulfonamide |
| SMILES | CN(C)c1cnnc(Nc2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2)c1 |
| InChI | InChI=1S/C18H18N6O4S/c1-23(2)16-11-18(21-19-12-16)20-13-3-5-14(6-4-13)22-29(27,28)17-9-7-15(8-10-17)24(25)26/h3-12,22H,1-2H3,(H,20,21) |
| InChIKey | WAAPEABTQJMINS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|