C24H23N5O3S — CID 122321888
N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-4-phenoxybenzenesulfonamide (PubChem CID 122321888) has the molecular formula C24H23N5O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-4-phenoxybenzenesulfonamide.
| Compound Name | N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 122321888 |
| Molecular Formula | C24H23N5O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-4-phenoxybenzenesulfonamide |
| SMILES | CN(C)c1cnnc(Nc2ccc(NS(=O)(=O)c3ccc(Oc4ccccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C24H23N5O3S/c1-29(2)20-16-24(27-25-17-20)26-18-8-10-19(11-9-18)28-33(30,31)23-14-12-22(13-15-23)32-21-6-4-3-5-7-21/h3-17,28H,1-2H3,(H,26,27) |
| InChIKey | OLIQSJWXWIGSQW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |