C26H25N5O2S — CID 122354613
4-phenyl-N-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]benzenesulfonamide (PubChem CID 122354613) has the molecular formula C26H25N5O2S and a molecular weight of 471.59 g/mol. Its IUPAC name is 4-phenyl-N-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]benzenesulfonamide.
| Compound Name | 4-phenyl-N-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122354613 |
| Molecular Formula | C26H25N5O2S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 4-phenyl-N-[4-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2cc(N3CCCC3)cnn2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N5O2S/c32-34(33,25-14-8-21(9-15-25)20-6-2-1-3-7-20)30-23-12-10-22(11-13-23)28-26-18-24(19-27-29-26)31-16-4-5-17-31/h1-3,6-15,18-19,30H,4-5,16-17H2,(H,28,29) |
| InChIKey | MROBCOQPYAVIOP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |