C28H26N2O7 — CID 1223277
[3-acetyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylindol-5-yl] 2-nitrobenzoate (PubChem CID 1223277) has the molecular formula C28H26N2O7 and a molecular weight of 502.52 g/mol. Its IUPAC name is [3-acetyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylindol-5-yl] 2-nitrobenzoate.
| Compound Name | [3-acetyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylindol-5-yl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 1223277 |
| Molecular Formula | C28H26N2O7 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | [3-acetyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylindol-5-yl] 2-nitrobenzoate |
| SMILES | COc1ccc(CCn2c(C)c(C(C)=O)c3cc(OC(=O)c4ccccc4[N+](=O)[O-])ccc32)cc1OC |
| InChI | InChI=1S/C28H26N2O7/c1-17-27(18(2)31)22-16-20(37-28(32)21-7-5-6-8-24(21)30(33)34)10-11-23(22)29(17)14-13-19-9-12-25(35-3)26(15-19)36-4/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | CRDWSJIURSKSQS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 109.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|