About [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone
[2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone (PubChem CID 122329422) has the molecular formula C17H13ClN2O2S2
and a molecular weight of 376.89 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone.
Molecular Properties
| Compound Name | [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone |
| PubChem CID | 122329422 |
| Molecular Formula | C17H13ClN2O2S2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1cc(-c2cccs2)on1)N1CCSC1c1ccccc1Cl |
| InChI | InChI=1S/C17H13ClN2O2S2/c18-12-5-2-1-4-11(12)17-20(7-9-24-17)16(21)13-10-14(22-19-13)15-6-3-8-23-15/h1-6,8,10,17H,7,9H2 |
| InChIKey | WPZLSNRJCQCLHF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone?
The IUPAC name of [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone (CID 122329422) is [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone.
What is the SMILES notation for [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone?
The canonical SMILES for [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone is O=C(c1cc(-c2cccs2)on1)N1CCSC1c1ccccc1Cl.
What is the InChIKey of [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone?
The InChIKey is WPZLSNRJCQCLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN2O2S2/c18-12-5-2-1-4-11(12)17-20(7-9-24-17)16(21)13-10-14(22-19-13)15-6-3-8-23-15/h1-6,8,10,17H,7,9H2.
What are the key properties of [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone?
[2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone has a molecular weight of 376.89 g/mol, XLogP of 4.94, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone is sourced from PubChem (CID 122329422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).