C20H20N2O3S — CID 122330326
[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-indolizin-2-ylmethanone (PubChem CID 122330326) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-indolizin-2-ylmethanone.
| Compound Name | [2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-indolizin-2-ylmethanone |
|---|---|
| PubChem CID | 122330326 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-indolizin-2-ylmethanone |
| SMILES | COc1ccc(OC)c(C2SCCN2C(=O)c2cc3ccccn3c2)c1 |
| InChI | InChI=1S/C20H20N2O3S/c1-24-16-6-7-18(25-2)17(12-16)20-22(9-10-26-20)19(23)14-11-15-5-3-4-8-21(15)13-14/h3-8,11-13,20H,9-10H2,1-2H3 |
| InChIKey | RPADFINARPGTPU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |