C22H29NO3S — CID 42781031
1-adamantyl-[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]methanone (PubChem CID 42781031) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is 1-adamantyl-[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]methanone.
| Compound Name | 1-adamantyl-[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]methanone |
|---|---|
| PubChem CID | 42781031 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-adamantyl-[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]methanone |
| SMILES | COc1ccc(OC)c(C2SCCN2C(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H29NO3S/c1-25-17-3-4-19(26-2)18(10-17)20-23(5-6-27-20)21(24)22-11-14-7-15(12-22)9-16(8-14)13-22/h3-4,10,14-16,20H,5-9,11-13H2,1-2H3 |
| InChIKey | AEIIOMYAJYYCKA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |