C16H22ClNO3S — CID 3422650
3-chloro-1-[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-2,2-dimethylpropan-1-one (PubChem CID 3422650) has the molecular formula C16H22ClNO3S and a molecular weight of 343.88 g/mol. Its IUPAC name is 3-chloro-1-[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 3422650 |
| Molecular Formula | C16H22ClNO3S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-chloro-1-[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1ccc(OC)c(C2SCCN2C(=O)C(C)(C)CCl)c1 |
| InChI | InChI=1S/C16H22ClNO3S/c1-16(2,10-17)15(19)18-7-8-22-14(18)12-9-11(20-3)5-6-13(12)21-4/h5-6,9,14H,7-8,10H2,1-4H3 |
| InChIKey | IVNZMIQGUWSSBB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|