C21H22FNO4S — CID 122330857
(E)-3-(2-fluorophenyl)-1-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]prop-2-en-1-one (PubChem CID 122330857) has the molecular formula C21H22FNO4S and a molecular weight of 403.48 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-1-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-fluorophenyl)-1-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122330857 |
| Molecular Formula | C21H22FNO4S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-1-[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]prop-2-en-1-one |
| SMILES | COc1cc(OC)c(C2SCCN2C(=O)/C=C/c2ccccc2F)cc1OC |
| InChI | InChI=1S/C21H22FNO4S/c1-25-17-13-19(27-3)18(26-2)12-15(17)21-23(10-11-28-21)20(24)9-8-14-6-4-5-7-16(14)22/h4-9,12-13,21H,10-11H2,1-3H3/b9-8+ |
| InChIKey | KFOJAMOHMZVSJP-CMDGGOBGSA-N |
| XLogP | 4.14 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|