C19H18ClNOS — CID 122329426
(E)-1-[2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-3-(2-methylphenyl)prop-2-en-1-one (PubChem CID 122329426) has the molecular formula C19H18ClNOS and a molecular weight of 343.88 g/mol. Its IUPAC name is (E)-1-[2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-3-(2-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-3-(2-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122329426 |
| Molecular Formula | C19H18ClNOS |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (E)-1-[2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-3-(2-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccccc1/C=C/C(=O)N1CCSC1c1ccccc1Cl |
| InChI | InChI=1S/C19H18ClNOS/c1-14-6-2-3-7-15(14)10-11-18(22)21-12-13-23-19(21)16-8-4-5-9-17(16)20/h2-11,19H,12-13H2,1H3/b11-10+ |
| InChIKey | IPNKCPXBKSBZFU-ZHACJKMWSA-N |
| XLogP | 4.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|