C18H15ClFNOS — CID 122329427
(E)-1-[2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-3-(2-fluorophenyl)prop-2-en-1-one (PubChem CID 122329427) has the molecular formula C18H15ClFNOS and a molecular weight of 347.84 g/mol. Its IUPAC name is (E)-1-[2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-3-(2-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-3-(2-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122329427 |
| Molecular Formula | C18H15ClFNOS |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (E)-1-[2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-3-(2-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1F)N1CCSC1c1ccccc1Cl |
| InChI | InChI=1S/C18H15ClFNOS/c19-15-7-3-2-6-14(15)18-21(11-12-23-18)17(22)10-9-13-5-1-4-8-16(13)20/h1-10,18H,11-12H2/b10-9+ |
| InChIKey | CTXSRPZKEYWVLI-MDZDMXLPSA-N |
| XLogP | 4.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|